C15H19N5 — CID 114879025
4-cyclohexyl-6-(4-methyl-3-pyridinyl)-1,3,5-triazin-2-amine (PubChem CID 114879025) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 4-cyclohexyl-6-(4-methyl-3-pyridinyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclohexyl-6-(4-methyl-3-pyridinyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114879025 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-cyclohexyl-6-(4-methyl-3-pyridinyl)-1,3,5-triazin-2-amine |
| SMILES | Cc1ccncc1-c1nc(N)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C15H19N5/c1-10-7-8-17-9-12(10)14-18-13(19-15(16)20-14)11-5-3-2-4-6-11/h7-9,11H,2-6H2,1H3,(H2,16,18,19,20) |
| InChIKey | HNRNWWRVYHWFOC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |