C11H9Cl2N3 — CID 114879324
6-(3,5-dichlorophenyl)-N-methylpyrazin-2-amine (PubChem CID 114879324) has the molecular formula C11H9Cl2N3 and a molecular weight of 254.12 g/mol. Its IUPAC name is 6-(3,5-dichlorophenyl)-N-methylpyrazin-2-amine.
| Compound Name | 6-(3,5-dichlorophenyl)-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 114879324 |
| Molecular Formula | C11H9Cl2N3 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 6-(3,5-dichlorophenyl)-N-methylpyrazin-2-amine |
| SMILES | CNc1cncc(-c2cc(Cl)cc(Cl)c2)n1 |
| InChI | InChI=1S/C11H9Cl2N3/c1-14-11-6-15-5-10(16-11)7-2-8(12)4-9(13)3-7/h2-6H,1H3,(H,14,16) |
| InChIKey | VBQGOKODIRCVNS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |