About 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole
3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole (PubChem CID 11487950) has the molecular formula C28H27FN2O3
and a molecular weight of 458.53 g/mol. Its IUPAC name is 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole.
Molecular Properties
| Compound Name | 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole |
| PubChem CID | 11487950 |
| Molecular Formula | C28H27FN2O3 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole |
| SMILES | COC1(c2cc(F)cc(OCc3cc(-c4ccccc4)n(-c4ccccc4)n3)c2)CCOCC1 |
| InChI | InChI=1S/C28H27FN2O3/c1-32-28(12-14-33-15-13-28)22-16-23(29)18-26(17-22)34-20-24-19-27(21-8-4-2-5-9-21)31(30-24)25-10-6-3-7-11-25/h2-11,16-19H,12-15,20H2,1H3 |
| InChIKey | KJSXZRPNUTVPIS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole?
The IUPAC name of 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole (CID 11487950) is 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole.
What is the SMILES notation for 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole?
The canonical SMILES for 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole is COC1(c2cc(F)cc(OCc3cc(-c4ccccc4)n(-c4ccccc4)n3)c2)CCOCC1.
What is the InChIKey of 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole?
The InChIKey is KJSXZRPNUTVPIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27FN2O3/c1-32-28(12-14-33-15-13-28)22-16-23(29)18-26(17-22)34-20-24-19-27(21-8-4-2-5-9-21)31(30-24)25-10-6-3-7-11-25/h2-11,16-19H,12-15,20H2,1H3.
What are the key properties of 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole?
3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole has a molecular weight of 458.53 g/mol, XLogP of 5.91, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-fluoro-5-(4-methoxyoxan-4-yl)phenoxy]methyl]-1,5-diphenylpyrazole is sourced from PubChem (CID 11487950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).