C23H26F3N5O2 — CID 11488029
N-(3-cyclopropylpropyl)-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide (PubChem CID 11488029) has the molecular formula C23H26F3N5O2 and a molecular weight of 461.49 g/mol. Its IUPAC name is N-(3-cyclopropylpropyl)-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-(3-cyclopropylpropyl)-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 11488029 |
| Molecular Formula | C23H26F3N5O2 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-(3-cyclopropylpropyl)-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide |
| SMILES | O=C(NCCCC1CC1)c1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C23H26F3N5O2/c24-23(25,26)18-6-2-1-5-17(18)22(33)31-14-12-30(13-15-31)20-10-9-19(28-29-20)21(32)27-11-3-4-16-7-8-16/h1-2,5-6,9-10,16H,3-4,7-8,11-15H2,(H,27,32) |
| InChIKey | ALNBEEWFQUYNMP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|