C14H17BrN2S — CID 114882131
2-bromo-6-(dicyclopropylmethylamino)benzenecarbothioamide (PubChem CID 114882131) has the molecular formula C14H17BrN2S and a molecular weight of 325.28 g/mol. Its IUPAC name is 2-bromo-6-(dicyclopropylmethylamino)benzenecarbothioamide.
| Compound Name | 2-bromo-6-(dicyclopropylmethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 114882131 |
| Molecular Formula | C14H17BrN2S |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-bromo-6-(dicyclopropylmethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1c(Br)cccc1NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C14H17BrN2S/c15-10-2-1-3-11(12(10)14(16)18)17-13(8-4-5-8)9-6-7-9/h1-3,8-9,13,17H,4-7H2,(H2,16,18) |
| InChIKey | HLFYVGQOLYPTPO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|