C15H22BrN3O — CID 114883200
2-bromo-N'-hydroxy-6-[methyl-(2-methylcyclohexyl)amino]benzenecarboximidamide (PubChem CID 114883200) has the molecular formula C15H22BrN3O and a molecular weight of 340.27 g/mol. Its IUPAC name is 2-bromo-N'-hydroxy-6-[methyl-(2-methylcyclohexyl)amino]benzenecarboximidamide.
| Compound Name | 2-bromo-N'-hydroxy-6-[methyl-(2-methylcyclohexyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 114883200 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-bromo-N'-hydroxy-6-[methyl-(2-methylcyclohexyl)amino]benzenecarboximidamide |
| SMILES | CC1CCCCC1N(C)c1cccc(Br)c1/C(N)=N/O |
| InChI | InChI=1S/C15H22BrN3O/c1-10-6-3-4-8-12(10)19(2)13-9-5-7-11(16)14(13)15(17)18-20/h5,7,9-10,12,20H,3-4,6,8H2,1-2H3,(H2,17,18) |
| InChIKey | DXJWILLPKQRNHU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|