About 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine
6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine (PubChem CID 11488363) has the molecular formula C25H26FN7O2
and a molecular weight of 475.53 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine.
Molecular Properties
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine |
| PubChem CID | 11488363 |
| Molecular Formula | C25H26FN7O2 |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine |
| SMILES | COc1ccc(-c2cnc3nc(N)nc(N4CCN(Cc5ccccc5F)CC4)c3n2)cc1OC |
| InChI | InChI=1S/C25H26FN7O2/c1-34-20-8-7-16(13-21(20)35-2)19-14-28-23-22(29-19)24(31-25(27)30-23)33-11-9-32(10-12-33)15-17-5-3-4-6-18(17)26/h3-8,13-14H,9-12,15H2,1-2H3,(H2,27,28,30,31) |
| InChIKey | LKFOASGDOSYBKN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine?
The IUPAC name of 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine (CID 11488363) is 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine.
What is the SMILES notation for 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine?
The canonical SMILES for 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine is COc1ccc(-c2cnc3nc(N)nc(N4CCN(Cc5ccccc5F)CC4)c3n2)cc1OC.
What is the InChIKey of 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine?
The InChIKey is LKFOASGDOSYBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26FN7O2/c1-34-20-8-7-16(13-21(20)35-2)19-14-28-23-22(29-19)24(31-25(27)30-23)33-11-9-32(10-12-33)15-17-5-3-4-6-18(17)26/h3-8,13-14H,9-12,15H2,1-2H3,(H2,27,28,30,31).
What are the key properties of 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine?
6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine has a molecular weight of 475.53 g/mol, XLogP of 3.15, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dimethoxyphenyl)-4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]pteridin-2-amine is sourced from PubChem (CID 11488363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).