C25H30F2N2O3S — CID 11488388
8-[3-[bis(4-fluorophenyl)methoxy]propyl]-3-(methylsulfanylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 11488388) has the molecular formula C25H30F2N2O3S and a molecular weight of 476.59 g/mol. Its IUPAC name is 8-[3-[bis(4-fluorophenyl)methoxy]propyl]-3-(methylsulfanylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[3-[bis(4-fluorophenyl)methoxy]propyl]-3-(methylsulfanylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 11488388 |
| Molecular Formula | C25H30F2N2O3S |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 8-[3-[bis(4-fluorophenyl)methoxy]propyl]-3-(methylsulfanylmethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | CSCN1CC2(CCN(CCCOC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)OC1=O |
| InChI | InChI=1S/C25H30F2N2O3S/c1-33-18-29-17-25(32-24(29)30)11-14-28(15-12-25)13-2-16-31-23(19-3-7-21(26)8-4-19)20-5-9-22(27)10-6-20/h3-10,23H,2,11-18H2,1H3 |
| InChIKey | XRNFCUKHUSENQO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|