C13H18BrN3O — CID 114884842
2-(3-amino-4-methylpiperidin-1-yl)-6-bromobenzamide (PubChem CID 114884842) has the molecular formula C13H18BrN3O and a molecular weight of 312.21 g/mol. Its IUPAC name is 2-(3-amino-4-methylpiperidin-1-yl)-6-bromobenzamide.
| Compound Name | 2-(3-amino-4-methylpiperidin-1-yl)-6-bromobenzamide |
|---|---|
| PubChem CID | 114884842 |
| Molecular Formula | C13H18BrN3O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-(3-amino-4-methylpiperidin-1-yl)-6-bromobenzamide |
| SMILES | CC1CCN(c2cccc(Br)c2C(N)=O)CC1N |
| InChI | InChI=1S/C13H18BrN3O/c1-8-5-6-17(7-10(8)15)11-4-2-3-9(14)12(11)13(16)18/h2-4,8,10H,5-7,15H2,1H3,(H2,16,18) |
| InChIKey | HZRUMPUEQHKAMY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |