C13H16ClFO — CID 114885174
1-(5-chloro-2-fluorophenyl)-4,4-dimethylpentan-1-one (PubChem CID 114885174) has the molecular formula C13H16ClFO and a molecular weight of 242.72 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)-4,4-dimethylpentan-1-one.
| Compound Name | 1-(5-chloro-2-fluorophenyl)-4,4-dimethylpentan-1-one |
|---|---|
| PubChem CID | 114885174 |
| Molecular Formula | C13H16ClFO |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)-4,4-dimethylpentan-1-one |
| SMILES | CC(C)(C)CCC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C13H16ClFO/c1-13(2,3)7-6-12(16)10-8-9(14)4-5-11(10)15/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | NTUIQVAXPZPIAO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |