C18H31IO5Si — CID 11488533
(2R)-2-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one (PubChem CID 11488533) has the molecular formula C18H31IO5Si and a molecular weight of 482.43 g/mol. Its IUPAC name is (2R)-2-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11488533 |
| Molecular Formula | C18H31IO5Si |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | (2R)-2-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-4-(methoxymethoxy)-2,3-dihydropyran-6-one |
| SMILES | COCOC1=CC(=O)O[C@H](C[C@@H](C/C=C/I)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H31IO5Si/c1-18(2,3)25(5,6)24-14(8-7-9-19)10-16-11-15(22-13-21-4)12-17(20)23-16/h7,9,12,14,16H,8,10-11,13H2,1-6H3/b9-7+/t14-,16-/m1/s1 |
| InChIKey | YXJJARYVVGZDDJ-JNYVMKGUSA-N |
| XLogP | 4.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|