C13H18BrFO — CID 114885662
1-(2-bromo-6-fluorophenyl)-4,4-dimethylpentan-1-ol (PubChem CID 114885662) has the molecular formula C13H18BrFO and a molecular weight of 289.19 g/mol. Its IUPAC name is 1-(2-bromo-6-fluorophenyl)-4,4-dimethylpentan-1-ol.
| Compound Name | 1-(2-bromo-6-fluorophenyl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 114885662 |
| Molecular Formula | C13H18BrFO |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 1-(2-bromo-6-fluorophenyl)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)CCC(O)c1c(F)cccc1Br |
| InChI | InChI=1S/C13H18BrFO/c1-13(2,3)8-7-11(16)12-9(14)5-4-6-10(12)15/h4-6,11,16H,7-8H2,1-3H3 |
| InChIKey | JROUSWITXNRMEA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |