C26H45NO7 — CID 11488575
[(Z,2S,3S,4R)-2-acetamido-3,4-diacetyloxyoctadec-9-enyl] acetate (PubChem CID 11488575) has the molecular formula C26H45NO7 and a molecular weight of 483.65 g/mol. Its IUPAC name is [(Z,2S,3S,4R)-2-acetamido-3,4-diacetyloxyoctadec-9-enyl] acetate.
| Compound Name | [(Z,2S,3S,4R)-2-acetamido-3,4-diacetyloxyoctadec-9-enyl] acetate |
|---|---|
| PubChem CID | 11488575 |
| Molecular Formula | C26H45NO7 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | [(Z,2S,3S,4R)-2-acetamido-3,4-diacetyloxyoctadec-9-enyl] acetate |
| SMILES | CCCCCCCC/C=C\CCCC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](COC(C)=O)NC(C)=O |
| InChI | InChI=1S/C26H45NO7/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-25(33-22(4)30)26(34-23(5)31)24(27-20(2)28)19-32-21(3)29/h13-14,24-26H,6-12,15-19H2,1-5H3,(H,27,28)/b14-13-/t24-,25+,26-/m0/s1 |
| InChIKey | XWEOAXMZNJVODZ-DZPPFCDLSA-N |
| XLogP | 4.78 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|