C26H37NO6Si — CID 11488679
methyl (4aR,7R,7aS)-7-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6-[(4-methoxyphenyl)methyl]-2,2,7a-trimethyl-5-oxo-4,4a-dihydro-3H-oxasilino[5,6-c]pyrrole-7-carboxylate (PubChem CID 11488679) has the molecular formula C26H37NO6Si and a molecular weight of 487.67 g/mol. Its IUPAC name is methyl (4aR,7R,7aS)-7-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6-[(4-methoxyphenyl)methyl]-2,2,7a-trimethyl-5-oxo-4,4a-dihydro-3H-oxasilino[5,6-c]pyrrole-7-carboxylate.
| Compound Name | methyl (4aR,7R,7aS)-7-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6-[(4-methoxyphenyl)methyl]-2,2,7a-trimethyl-5-oxo-4,4a-dihydro-3H-oxasilino[5,6-c]pyrrole-7-carboxylate |
|---|---|
| PubChem CID | 11488679 |
| Molecular Formula | C26H37NO6Si |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | methyl (4aR,7R,7aS)-7-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6-[(4-methoxyphenyl)methyl]-2,2,7a-trimethyl-5-oxo-4,4a-dihydro-3H-oxasilino[5,6-c]pyrrole-7-carboxylate |
| SMILES | COC(=O)[C@]1([C@@H](O)[C@@H]2C=CCCC2)N(Cc2ccc(OC)cc2)C(=O)[C@@H]2CC[Si](C)(C)O[C@@]21C |
| InChI | InChI=1S/C26H37NO6Si/c1-25-21(15-16-34(4,5)33-25)23(29)27(17-18-11-13-20(31-2)14-12-18)26(25,24(30)32-3)22(28)19-9-7-6-8-10-19/h7,9,11-14,19,21-22,28H,6,8,10,15-17H2,1-5H3/t19-,21+,22+,25+,26+/m1/s1 |
| InChIKey | NHYSMJOFOJMEBZ-DEZQZRQMSA-N |
| XLogP | 3.67 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|