C14H16BrClFN3 — CID 114887114
1-(2-bromo-6-fluorophenyl)-1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methylmethanamine (PubChem CID 114887114) has the molecular formula C14H16BrClFN3 and a molecular weight of 360.66 g/mol. Its IUPAC name is 1-(2-bromo-6-fluorophenyl)-1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methylmethanamine.
| Compound Name | 1-(2-bromo-6-fluorophenyl)-1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114887114 |
| Molecular Formula | C14H16BrClFN3 |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 1-(2-bromo-6-fluorophenyl)-1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-N-methylmethanamine |
| SMILES | CNC(c1c(F)cccc1Br)c1c(Cl)cnn1C(C)C |
| InChI | InChI=1S/C14H16BrClFN3/c1-8(2)20-14(10(16)7-19-20)13(18-3)12-9(15)5-4-6-11(12)17/h4-8,13,18H,1-3H3 |
| InChIKey | AFCXLFGEGOVVGA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |