C28H27ClN2O4 — CID 11488726
3-[4-[3-[[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]methyl]phenoxy]-2-methylphenyl]propanoic acid (PubChem CID 11488726) has the molecular formula C28H27ClN2O4 and a molecular weight of 490.99 g/mol. Its IUPAC name is 3-[4-[3-[[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]methyl]phenoxy]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[3-[[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]methyl]phenoxy]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 11488726 |
| Molecular Formula | C28H27ClN2O4 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3-[4-[3-[[(5-chloro-1,3-dimethylindole-2-carbonyl)amino]methyl]phenoxy]-2-methylphenyl]propanoic acid |
| SMILES | Cc1cc(Oc2cccc(CNC(=O)c3c(C)c4cc(Cl)ccc4n3C)c2)ccc1CCC(=O)O |
| InChI | InChI=1S/C28H27ClN2O4/c1-17-13-23(10-7-20(17)8-12-26(32)33)35-22-6-4-5-19(14-22)16-30-28(34)27-18(2)24-15-21(29)9-11-25(24)31(27)3/h4-7,9-11,13-15H,8,12,16H2,1-3H3,(H,30,34)(H,32,33) |
| InChIKey | SYVYIPUEDUCDLG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|