C16H18BrFN2 — CID 114887468
N-[(2-bromo-6-fluorophenyl)-(4-methyl-3-pyridinyl)methyl]propan-1-amine (PubChem CID 114887468) has the molecular formula C16H18BrFN2 and a molecular weight of 337.24 g/mol. Its IUPAC name is N-[(2-bromo-6-fluorophenyl)-(4-methyl-3-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(2-bromo-6-fluorophenyl)-(4-methyl-3-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114887468 |
| Molecular Formula | C16H18BrFN2 |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[(2-bromo-6-fluorophenyl)-(4-methyl-3-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cnccc1C)c1c(F)cccc1Br |
| InChI | InChI=1S/C16H18BrFN2/c1-3-8-20-16(12-10-19-9-7-11(12)2)15-13(17)5-4-6-14(15)18/h4-7,9-10,16,20H,3,8H2,1-2H3 |
| InChIKey | PAKJPEJSQJGFBS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |