C14H18BrNO2 — CID 114888260
2-bromo-6-(3,3-dimethylpiperidin-1-yl)benzoic acid (PubChem CID 114888260) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is 2-bromo-6-(3,3-dimethylpiperidin-1-yl)benzoic acid.
| Compound Name | 2-bromo-6-(3,3-dimethylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 114888260 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-bromo-6-(3,3-dimethylpiperidin-1-yl)benzoic acid |
| SMILES | CC1(C)CCCN(c2cccc(Br)c2C(=O)O)C1 |
| InChI | InChI=1S/C14H18BrNO2/c1-14(2)7-4-8-16(9-14)11-6-3-5-10(15)12(11)13(17)18/h3,5-6H,4,7-9H2,1-2H3,(H,17,18) |
| InChIKey | RTGYIWCUUIOAPH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |