C20H16F5N7O3 — CID 11488852
2,4-difluoro-N-methoxy-5-[[5-propan-2-yl-6-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide (PubChem CID 11488852) has the molecular formula C20H16F5N7O3 and a molecular weight of 497.38 g/mol. Its IUPAC name is 2,4-difluoro-N-methoxy-5-[[5-propan-2-yl-6-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide.
| Compound Name | 2,4-difluoro-N-methoxy-5-[[5-propan-2-yl-6-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 11488852 |
| Molecular Formula | C20H16F5N7O3 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2,4-difluoro-N-methoxy-5-[[5-propan-2-yl-6-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide |
| SMILES | CONC(=O)c1cc(Nc2ncnn3cc(-c4nnc(C(F)(F)F)o4)c(C(C)C)c23)c(F)cc1F |
| InChI | InChI=1S/C20H16F5N7O3/c1-8(2)14-10(18-29-30-19(35-18)20(23,24)25)6-32-15(14)16(26-7-27-32)28-13-4-9(17(33)31-34-3)11(21)5-12(13)22/h4-8H,1-3H3,(H,31,33)(H,26,27,28) |
| InChIKey | JLXBHBVYBGZIEY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|