C12H19BrN2 — CID 114889459
2-(aminomethyl)-4-bromo-N-butan-2-yl-N-methylaniline (PubChem CID 114889459) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 2-(aminomethyl)-4-bromo-N-butan-2-yl-N-methylaniline.
| Compound Name | 2-(aminomethyl)-4-bromo-N-butan-2-yl-N-methylaniline |
|---|---|
| PubChem CID | 114889459 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(aminomethyl)-4-bromo-N-butan-2-yl-N-methylaniline |
| SMILES | CCC(C)N(C)c1ccc(Br)cc1CN |
| InChI | InChI=1S/C12H19BrN2/c1-4-9(2)15(3)12-6-5-11(13)7-10(12)8-14/h5-7,9H,4,8,14H2,1-3H3 |
| InChIKey | MTFVXSZRDQWCGQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |