About dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate
dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 11488982) has the molecular formula C28H26NO6P
and a molecular weight of 503.49 g/mol. Its IUPAC name is dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate.
Molecular Properties
| Compound Name | dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| PubChem CID | 11488982 |
| Molecular Formula | C28H26NO6P |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | COC(=O)C(C(C(=O)OC)N1C(=O)CCC1=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26NO6P/c1-34-27(32)25(29-23(30)18-19-24(29)31)26(28(33)35-2)36(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,25H,18-19H2,1-2H3 |
| InChIKey | DAWVYWCOXMRLMD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate?
The IUPAC name of dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate (CID 11488982) is dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate.
What is the SMILES notation for dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate?
The canonical SMILES for dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate is COC(=O)C(C(C(=O)OC)N1C(=O)CCC1=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate?
The InChIKey is DAWVYWCOXMRLMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26NO6P/c1-34-27(32)25(29-23(30)18-19-24(29)31)26(28(33)35-2)36(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,25H,18-19H2,1-2H3.
What are the key properties of dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate?
dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate has a molecular weight of 503.49 g/mol, XLogP of 2.02, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(2,5-dioxopyrrolidin-1-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate is sourced from PubChem (CID 11488982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).