C28H50O6Si — CID 11489104
(5R,6R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3-methylhex-2-enyl]-6-[2-(1,3-dioxolan-2-yl)ethyl]-3-ethoxy-5,6-dimethylcyclohex-2-en-1-one (PubChem CID 11489104) has the molecular formula C28H50O6Si and a molecular weight of 510.79 g/mol. Its IUPAC name is (5R,6R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3-methylhex-2-enyl]-6-[2-(1,3-dioxolan-2-yl)ethyl]-3-ethoxy-5,6-dimethylcyclohex-2-en-1-one.
| Compound Name | (5R,6R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3-methylhex-2-enyl]-6-[2-(1,3-dioxolan-2-yl)ethyl]-3-ethoxy-5,6-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11489104 |
| Molecular Formula | C28H50O6Si |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | (5R,6R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3-methylhex-2-enyl]-6-[2-(1,3-dioxolan-2-yl)ethyl]-3-ethoxy-5,6-dimethylcyclohex-2-en-1-one |
| SMILES | CCOC1=C(C(O)/C=C(\C)CCCO[Si](C)(C)C(C)(C)C)C(=O)[C@](C)(CCC2OCCO2)[C@H](C)C1 |
| InChI | InChI=1S/C28H50O6Si/c1-10-31-23-19-21(3)28(7,14-13-24-32-16-17-33-24)26(30)25(23)22(29)18-20(2)12-11-15-34-35(8,9)27(4,5)6/h18,21-22,24,29H,10-17,19H2,1-9H3/b20-18+/t21-,22?,28-/m1/s1 |
| InChIKey | UAFVDRAVUJXFMQ-QYJKWLOKSA-N |
| XLogP | 6.15 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|