C13H6BrF2NO — CID 114891054
5-bromo-2-(3,5-difluorophenoxy)benzonitrile (PubChem CID 114891054) has the molecular formula C13H6BrF2NO and a molecular weight of 310.10 g/mol. Its IUPAC name is 5-bromo-2-(3,5-difluorophenoxy)benzonitrile.
| Compound Name | 5-bromo-2-(3,5-difluorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 114891054 |
| Molecular Formula | C13H6BrF2NO |
| Molecular Weight | 310.10 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | 5-bromo-2-(3,5-difluorophenoxy)benzonitrile |
| SMILES | N#Cc1cc(Br)ccc1Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H6BrF2NO/c14-9-1-2-13(8(3-9)7-17)18-12-5-10(15)4-11(16)6-12/h1-6H |
| InChIKey | QJYBISCLHNFUCR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.10 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |