C14H15BrN2OS — CID 114891439
5-bromo-2-[ethyl(furan-2-ylmethyl)amino]benzenecarbothioamide (PubChem CID 114891439) has the molecular formula C14H15BrN2OS and a molecular weight of 339.26 g/mol. Its IUPAC name is 5-bromo-2-[ethyl(furan-2-ylmethyl)amino]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[ethyl(furan-2-ylmethyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114891439 |
| Molecular Formula | C14H15BrN2OS |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 5-bromo-2-[ethyl(furan-2-ylmethyl)amino]benzenecarbothioamide |
| SMILES | CCN(Cc1ccco1)c1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C14H15BrN2OS/c1-2-17(9-11-4-3-7-18-11)13-6-5-10(15)8-12(13)14(16)19/h3-8H,2,9H2,1H3,(H2,16,19) |
| InChIKey | LIXXKNCXTDBXRT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|