C16H16BrN3S — CID 114891800
5-bromo-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarbothioamide (PubChem CID 114891800) has the molecular formula C16H16BrN3S and a molecular weight of 362.30 g/mol. Its IUPAC name is 5-bromo-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarbothioamide.
| Compound Name | 5-bromo-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114891800 |
| Molecular Formula | C16H16BrN3S |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 5-bromo-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarbothioamide |
| SMILES | CN1CCN(c2ccc(Br)cc2C(N)=S)c2ccccc21 |
| InChI | InChI=1S/C16H16BrN3S/c1-19-8-9-20(15-5-3-2-4-14(15)19)13-7-6-11(17)10-12(13)16(18)21/h2-7,10H,8-9H2,1H3,(H2,18,21) |
| InChIKey | BSQAUVBUZDHBOC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|