C32H36O6 — CID 11489217
ethyl (2E,4E)-5-[11-[(1E,3E)-5-ethoxy-3-methoxy-5-oxopenta-1,3-dienyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-3-methoxypenta-2,4-dienoate (PubChem CID 11489217) has the molecular formula C32H36O6 and a molecular weight of 516.63 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[11-[(1E,3E)-5-ethoxy-3-methoxy-5-oxopenta-1,3-dienyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-3-methoxypenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[11-[(1E,3E)-5-ethoxy-3-methoxy-5-oxopenta-1,3-dienyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-3-methoxypenta-2,4-dienoate |
|---|---|
| PubChem CID | 11489217 |
| Molecular Formula | C32H36O6 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | ethyl (2E,4E)-5-[11-[(1E,3E)-5-ethoxy-3-methoxy-5-oxopenta-1,3-dienyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-3-methoxypenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(\C=C\c1cc2ccc1CCc1ccc(c(/C=C/C(=C\C(=O)OCC)OC)c1)CC2)OC |
| InChI | InChI=1S/C32H36O6/c1-5-37-31(33)21-29(35-3)17-15-27-19-23-7-11-25(27)13-9-24-8-12-26(14-10-23)28(20-24)16-18-30(36-4)22-32(34)38-6-2/h7-8,11-12,15-22H,5-6,9-10,13-14H2,1-4H3/b17-15+,18-16+,29-21+,30-22+ |
| InChIKey | MNKOGFYZFCDZNI-OHAXRXBPSA-N |
| XLogP | 5.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|