C26H35ClN4O5 — CID 11489253
[1-[(2-chloropyrimidin-4-yl)oxymethyl]cyclobutyl]methyl N-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate (PubChem CID 11489253) has the molecular formula C26H35ClN4O5 and a molecular weight of 519.04 g/mol. Its IUPAC name is [1-[(2-chloropyrimidin-4-yl)oxymethyl]cyclobutyl]methyl N-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate.
| Compound Name | [1-[(2-chloropyrimidin-4-yl)oxymethyl]cyclobutyl]methyl N-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 11489253 |
| Molecular Formula | C26H35ClN4O5 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | [1-[(2-chloropyrimidin-4-yl)oxymethyl]cyclobutyl]methyl N-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OCC1(COc2ccnc(Cl)n2)CCC1)C(O)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H35ClN4O5/c1-3-4-11-20(22(32)23(33)29-18(2)19-9-6-5-7-10-19)30-25(34)36-17-26(13-8-14-26)16-35-21-12-15-28-24(27)31-21/h5-7,9-10,12,15,18,20,22,32H,3-4,8,11,13-14,16-17H2,1-2H3,(H,29,33)(H,30,34)/t18-,20+,22?/m1/s1 |
| InChIKey | ANADALCAUFAUPN-XAFCGNCNSA-N |
| XLogP | 4.20 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |