C13H15BrN4O — CID 114892684
5-bromo-N'-hydroxy-2-(2-propylimidazol-1-yl)benzenecarboximidamide (PubChem CID 114892684) has the molecular formula C13H15BrN4O and a molecular weight of 323.19 g/mol. Its IUPAC name is 5-bromo-N'-hydroxy-2-(2-propylimidazol-1-yl)benzenecarboximidamide.
| Compound Name | 5-bromo-N'-hydroxy-2-(2-propylimidazol-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 114892684 |
| Molecular Formula | C13H15BrN4O |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 5-bromo-N'-hydroxy-2-(2-propylimidazol-1-yl)benzenecarboximidamide |
| SMILES | CCCc1nccn1-c1ccc(Br)cc1/C(N)=N/O |
| InChI | InChI=1S/C13H15BrN4O/c1-2-3-12-16-6-7-18(12)11-5-4-9(14)8-10(11)13(15)17-19/h4-8,19H,2-3H2,1H3,(H2,15,17) |
| InChIKey | PSIOKGSRSMXZLJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|