C13H9BrCl2N2O2 — CID 114892753
5-bromo-2-(3,5-dichlorophenoxy)-N'-hydroxybenzenecarboximidamide (PubChem CID 114892753) has the molecular formula C13H9BrCl2N2O2 and a molecular weight of 376.04 g/mol. Its IUPAC name is 5-bromo-2-(3,5-dichlorophenoxy)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 5-bromo-2-(3,5-dichlorophenoxy)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114892753 |
| Molecular Formula | C13H9BrCl2N2O2 |
| Molecular Weight | 376.04 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | 5-bromo-2-(3,5-dichlorophenoxy)-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1cc(Br)ccc1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H9BrCl2N2O2/c14-7-1-2-12(11(3-7)13(17)18-19)20-10-5-8(15)4-9(16)6-10/h1-6,19H,(H2,17,18) |
| InChIKey | LKCAIVOIBSBXIV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.04 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|