C15H15BrN2S — CID 114893614
5-bromo-2-(2,5-dimethylphenyl)sulfanylbenzenecarboximidamide (PubChem CID 114893614) has the molecular formula C15H15BrN2S and a molecular weight of 335.27 g/mol. Its IUPAC name is 5-bromo-2-(2,5-dimethylphenyl)sulfanylbenzenecarboximidamide.
| Compound Name | 5-bromo-2-(2,5-dimethylphenyl)sulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 114893614 |
| Molecular Formula | C15H15BrN2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 5-bromo-2-(2,5-dimethylphenyl)sulfanylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Br)ccc1Sc1cc(C)ccc1C |
| InChI | InChI=1S/C15H15BrN2S/c1-9-3-4-10(2)14(7-9)19-13-6-5-11(16)8-12(13)15(17)18/h3-8H,1-2H3,(H3,17,18) |
| InChIKey | YRTCFSRTHYHJFA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|