C34H45NO2Si — CID 11489409
(6S)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-[(9-phenylfluoren-9-yl)amino]heptan-3-one (PubChem CID 11489409) has the molecular formula C34H45NO2Si and a molecular weight of 527.83 g/mol. Its IUPAC name is (6S)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-[(9-phenylfluoren-9-yl)amino]heptan-3-one.
| Compound Name | (6S)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-[(9-phenylfluoren-9-yl)amino]heptan-3-one |
|---|---|
| PubChem CID | 11489409 |
| Molecular Formula | C34H45NO2Si |
| Molecular Weight | 527.83 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | (6S)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-[(9-phenylfluoren-9-yl)amino]heptan-3-one |
| SMILES | CC(C)(C)C(=O)CC[C@@H](CO[Si](C)(C)C(C)(C)C)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H45NO2Si/c1-32(2,3)31(36)23-22-26(24-37-38(7,8)33(4,5)6)35-34(25-16-10-9-11-17-25)29-20-14-12-18-27(29)28-19-13-15-21-30(28)34/h9-21,26,35H,22-24H2,1-8H3/t26-/m0/s1 |
| InChIKey | DNUCNLCTWRKTGG-SANMLTNESA-N |
| XLogP | 8.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.83 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|