C15H13Br2F2N — CID 114894718
2-(2-bromo-4-fluorophenyl)-1-(5-bromo-2-fluorophenyl)-N-methylethanamine (PubChem CID 114894718) has the molecular formula C15H13Br2F2N and a molecular weight of 405.08 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-1-(5-bromo-2-fluorophenyl)-N-methylethanamine.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-1-(5-bromo-2-fluorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 114894718 |
| Molecular Formula | C15H13Br2F2N |
| Molecular Weight | 405.08 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1-(5-bromo-2-fluorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(F)cc1Br)c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H13Br2F2N/c1-20-15(12-7-10(16)3-5-14(12)19)6-9-2-4-11(18)8-13(9)17/h2-5,7-8,15,20H,6H2,1H3 |
| InChIKey | VYOUOSBCGGVCDK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.08 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |