C11H13BrFN — CID 114894862
1-(5-bromo-2-fluorophenyl)-N-ethylprop-2-en-1-amine (PubChem CID 114894862) has the molecular formula C11H13BrFN and a molecular weight of 258.13 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-N-ethylprop-2-en-1-amine.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-N-ethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 114894862 |
| Molecular Formula | C11H13BrFN |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-N-ethylprop-2-en-1-amine |
| SMILES | C=CC(NCC)c1cc(Br)ccc1F |
| InChI | InChI=1S/C11H13BrFN/c1-3-11(14-4-2)9-7-8(12)5-6-10(9)13/h3,5-7,11,14H,1,4H2,2H3 |
| InChIKey | XFJAUUZIEKAWFX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|