C27H27FN6O5 — CID 11489502
2-[[1-[4-[4-(2,2-dimethyl-1,3-dioxolane-4-carbonyl)piperazin-1-yl]-3-fluorophenyl]triazol-4-yl]methyl]isoindole-1,3-dione (PubChem CID 11489502) has the molecular formula C27H27FN6O5 and a molecular weight of 534.55 g/mol. Its IUPAC name is 2-[[1-[4-[4-(2,2-dimethyl-1,3-dioxolane-4-carbonyl)piperazin-1-yl]-3-fluorophenyl]triazol-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-[4-[4-(2,2-dimethyl-1,3-dioxolane-4-carbonyl)piperazin-1-yl]-3-fluorophenyl]triazol-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11489502 |
| Molecular Formula | C27H27FN6O5 |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 2-[[1-[4-[4-(2,2-dimethyl-1,3-dioxolane-4-carbonyl)piperazin-1-yl]-3-fluorophenyl]triazol-4-yl]methyl]isoindole-1,3-dione |
| SMILES | CC1(C)OCC(C(=O)N2CCN(c3ccc(-n4cc(CN5C(=O)c6ccccc6C5=O)nn4)cc3F)CC2)O1 |
| InChI | InChI=1S/C27H27FN6O5/c1-27(2)38-16-23(39-27)26(37)32-11-9-31(10-12-32)22-8-7-18(13-21(22)28)34-15-17(29-30-34)14-33-24(35)19-5-3-4-6-20(19)25(33)36/h3-8,13,15,23H,9-12,14,16H2,1-2H3 |
| InChIKey | BIMMWYXQNBJLAC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 110.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|