C16H16BrNO2 — CID 114895477
5-bromo-2-[2-(3-methylphenyl)ethylamino]benzoic acid (PubChem CID 114895477) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is 5-bromo-2-[2-(3-methylphenyl)ethylamino]benzoic acid.
| Compound Name | 5-bromo-2-[2-(3-methylphenyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 114895477 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 5-bromo-2-[2-(3-methylphenyl)ethylamino]benzoic acid |
| SMILES | Cc1cccc(CCNc2ccc(Br)cc2C(=O)O)c1 |
| InChI | InChI=1S/C16H16BrNO2/c1-11-3-2-4-12(9-11)7-8-18-15-6-5-13(17)10-14(15)16(19)20/h2-6,9-10,18H,7-8H2,1H3,(H,19,20) |
| InChIKey | QCSXRGKZMPIBAQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |