C14H17BrN2OS — CID 114896388
3-amino-5-bromo-N-(3-methylbutan-2-yl)-1-benzothiophene-2-carboxamide (PubChem CID 114896388) has the molecular formula C14H17BrN2OS and a molecular weight of 341.27 g/mol. Its IUPAC name is 3-amino-5-bromo-N-(3-methylbutan-2-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-5-bromo-N-(3-methylbutan-2-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114896388 |
| Molecular Formula | C14H17BrN2OS |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 3-amino-5-bromo-N-(3-methylbutan-2-yl)-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)C(C)NC(=O)c1sc2ccc(Br)cc2c1N |
| InChI | InChI=1S/C14H17BrN2OS/c1-7(2)8(3)17-14(18)13-12(16)10-6-9(15)4-5-11(10)19-13/h4-8H,16H2,1-3H3,(H,17,18) |
| InChIKey | OGOOCESDASLCRF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |