C30H45NO8 — CID 11489688
tert-butyl (4S)-4-[[(4R,5S)-4-[(1R)-1-hydroxyprop-2-enyl]-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11489688) has the molecular formula C30H45NO8 and a molecular weight of 547.69 g/mol. Its IUPAC name is tert-butyl (4S)-4-[[(4R,5S)-4-[(1R)-1-hydroxyprop-2-enyl]-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[[(4R,5S)-4-[(1R)-1-hydroxyprop-2-enyl]-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11489688 |
| Molecular Formula | C30H45NO8 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.31 |
| IUPAC Name | tert-butyl (4S)-4-[[(4R,5S)-4-[(1R)-1-hydroxyprop-2-enyl]-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@@H](O)[C@@]1(C[C@H]2COC(C)(C)N2C(=O)OC(C)(C)C)OC(C)(C)O[C@H]1[C@@H](C=C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H45NO8/c1-11-23(35-18-20-13-15-22(34-10)16-14-20)25-30(24(32)12-2,39-29(8,9)37-25)17-21-19-36-28(6,7)31(21)26(33)38-27(3,4)5/h11-16,21,23-25,32H,1-2,17-19H2,3-10H3/t21-,23+,24+,25-,30+/m0/s1 |
| InChIKey | MRRABHUISNUWEQ-VJVSKNLGSA-N |
| XLogP | 4.97 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|