C28H23NO7S2 — CID 11489716
phenyl (2R,6aS,12aR,12bR)-4,7,7,12,12-pentaoxo-2-phenyl-2,3,6,6a,12a,12b-hexahydro-[1,4]benzodithiino[3,2-h]quinoline-1-carboxylate (PubChem CID 11489716) has the molecular formula C28H23NO7S2 and a molecular weight of 549.63 g/mol. Its IUPAC name is phenyl (2R,6aS,12aR,12bR)-4,7,7,12,12-pentaoxo-2-phenyl-2,3,6,6a,12a,12b-hexahydro-[1,4]benzodithiino[3,2-h]quinoline-1-carboxylate.
| Compound Name | phenyl (2R,6aS,12aR,12bR)-4,7,7,12,12-pentaoxo-2-phenyl-2,3,6,6a,12a,12b-hexahydro-[1,4]benzodithiino[3,2-h]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 11489716 |
| Molecular Formula | C28H23NO7S2 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | phenyl (2R,6aS,12aR,12bR)-4,7,7,12,12-pentaoxo-2-phenyl-2,3,6,6a,12a,12b-hexahydro-[1,4]benzodithiino[3,2-h]quinoline-1-carboxylate |
| SMILES | O=C1C[C@H](c2ccccc2)N(C(=O)Oc2ccccc2)[C@@H]2C1=CC[C@H]1[C@@H]2S(=O)(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C28H23NO7S2/c30-22-17-21(18-9-3-1-4-10-18)29(28(31)36-19-11-5-2-6-12-19)26-20(22)15-16-25-27(26)38(34,35)24-14-8-7-13-23(24)37(25,32)33/h1-15,21,25-27H,16-17H2/t21-,25+,26-,27+/m1/s1 |
| InChIKey | UBJJVCJFXBSORR-DXXVALNZSA-N |
| XLogP | 3.90 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |