About 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid
3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid (PubChem CID 114898893) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid.
Molecular Properties
| Compound Name | 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid |
| PubChem CID | 114898893 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)NN1C(C)CCCC1C |
| InChI | InChI=1S/C11H20N2O3/c1-7-5-4-6-8(2)13(7)12-10(14)9(3)11(15)16/h7-9H,4-6H2,1-3H3,(H,12,14)(H,15,16) |
| InChIKey | GKRKYBBEIJOPBA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid?
The IUPAC name of 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid (CID 114898893) is 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid.
What is the SMILES notation for 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid?
The canonical SMILES for 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid is CC(C(=O)O)C(=O)NN1C(C)CCCC1C.
What is the InChIKey of 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid?
The InChIKey is GKRKYBBEIJOPBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-7-5-4-6-8(2)13(7)12-10(14)9(3)11(15)16/h7-9H,4-6H2,1-3H3,(H,12,14)(H,15,16).
What are the key properties of 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid?
3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid has a molecular weight of 228.29 g/mol, XLogP of 1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dimethylpiperidin-1-yl)amino]-2-methyl-3-oxopropanoic acid is sourced from PubChem (CID 114898893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).