About 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan
3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan (PubChem CID 11489916) has the molecular formula C18H12Br4O
and a molecular weight of 563.91 g/mol. Its IUPAC name is 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan.
Molecular Properties
| Compound Name | 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan |
| PubChem CID | 11489916 |
| Molecular Formula | C18H12Br4O |
| Molecular Weight | 563.91 g/mol |
| Exact Mass | 559.76 |
| IUPAC Name | 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan |
| SMILES | BrCc1c(-c2cccc(Br)c2)oc(-c2cccc(Br)c2)c1CBr |
| InChI | InChI=1S/C18H12Br4O/c19-9-15-16(10-20)18(12-4-2-6-14(22)8-12)23-17(15)11-3-1-5-13(21)7-11/h1-8H,9-10H2 |
| InChIKey | SXDBFLUXUQMYFS-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.91 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan?
The IUPAC name of 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan (CID 11489916) is 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan.
What is the SMILES notation for 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan?
The canonical SMILES for 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan is BrCc1c(-c2cccc(Br)c2)oc(-c2cccc(Br)c2)c1CBr.
What is the InChIKey of 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan?
The InChIKey is SXDBFLUXUQMYFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Br4O/c19-9-15-16(10-20)18(12-4-2-6-14(22)8-12)23-17(15)11-3-1-5-13(21)7-11/h1-8H,9-10H2.
What are the key properties of 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan?
3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan has a molecular weight of 563.91 g/mol, XLogP of 7.93, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(bromomethyl)-2,5-bis(3-bromophenyl)furan is sourced from PubChem (CID 11489916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).