C18H43IO5Si4 — CID 11490106
[(2R,3R,4S,5R,6R)-2-iodo-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane (PubChem CID 11490106) has the molecular formula C18H43IO5Si4 and a molecular weight of 578.79 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2-iodo-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3R,4S,5R,6R)-2-iodo-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11490106 |
| Molecular Formula | C18H43IO5Si4 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2-iodo-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC[C@H]1O[C@H](I)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C18H43IO5Si4/c1-25(2,3)20-13-14-15(22-26(4,5)6)16(23-27(7,8)9)17(18(19)21-14)24-28(10,11)12/h14-18H,13H2,1-12H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | OBTFIIYVPYFDOC-SFFUCWETSA-N |
| XLogP | 5.66 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|