C17H25BrN2S — CID 114903272
4-bromo-2-(4-tert-butylazepan-1-yl)benzenecarbothioamide (PubChem CID 114903272) has the molecular formula C17H25BrN2S and a molecular weight of 369.37 g/mol. Its IUPAC name is 4-bromo-2-(4-tert-butylazepan-1-yl)benzenecarbothioamide.
| Compound Name | 4-bromo-2-(4-tert-butylazepan-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114903272 |
| Molecular Formula | C17H25BrN2S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-bromo-2-(4-tert-butylazepan-1-yl)benzenecarbothioamide |
| SMILES | CC(C)(C)C1CCCN(c2cc(Br)ccc2C(N)=S)CC1 |
| InChI | InChI=1S/C17H25BrN2S/c1-17(2,3)12-5-4-9-20(10-8-12)15-11-13(18)6-7-14(15)16(19)21/h6-7,11-12H,4-5,8-10H2,1-3H3,(H2,19,21) |
| InChIKey | FOQGQNYARBXXQO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|