C14H14BrN3S — CID 114903605
4-bromo-2-(4,5,6,7-tetrahydrobenzimidazol-1-yl)benzenecarbothioamide (PubChem CID 114903605) has the molecular formula C14H14BrN3S and a molecular weight of 336.26 g/mol. Its IUPAC name is 4-bromo-2-(4,5,6,7-tetrahydrobenzimidazol-1-yl)benzenecarbothioamide.
| Compound Name | 4-bromo-2-(4,5,6,7-tetrahydrobenzimidazol-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114903605 |
| Molecular Formula | C14H14BrN3S |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 4-bromo-2-(4,5,6,7-tetrahydrobenzimidazol-1-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Br)cc1-n1cnc2c1CCCC2 |
| InChI | InChI=1S/C14H14BrN3S/c15-9-5-6-10(14(16)19)13(7-9)18-8-17-11-3-1-2-4-12(11)18/h5-8H,1-4H2,(H2,16,19) |
| InChIKey | OPXZVMJSGPRIQN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|