C13H20BrN3O2 — CID 114903982
4-bromo-N'-hydroxy-2-[3-hydroxypropyl(propan-2-yl)amino]benzenecarboximidamide (PubChem CID 114903982) has the molecular formula C13H20BrN3O2 and a molecular weight of 330.23 g/mol. Its IUPAC name is 4-bromo-N'-hydroxy-2-[3-hydroxypropyl(propan-2-yl)amino]benzenecarboximidamide.
| Compound Name | 4-bromo-N'-hydroxy-2-[3-hydroxypropyl(propan-2-yl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 114903982 |
| Molecular Formula | C13H20BrN3O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-bromo-N'-hydroxy-2-[3-hydroxypropyl(propan-2-yl)amino]benzenecarboximidamide |
| SMILES | CC(C)N(CCCO)c1cc(Br)ccc1/C(N)=N/O |
| InChI | InChI=1S/C13H20BrN3O2/c1-9(2)17(6-3-7-18)12-8-10(14)4-5-11(12)13(15)16-19/h4-5,8-9,18-19H,3,6-7H2,1-2H3,(H2,15,16) |
| InChIKey | VUDYEQAJFWHSSP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|