C37H42N4O3S — CID 11490514
N-[2-[4-(4-methylpiperazin-1-yl)butoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide (PubChem CID 11490514) has the molecular formula C37H42N4O3S and a molecular weight of 622.84 g/mol. Its IUPAC name is N-[2-[4-(4-methylpiperazin-1-yl)butoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide.
| Compound Name | N-[2-[4-(4-methylpiperazin-1-yl)butoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 11490514 |
| Molecular Formula | C37H42N4O3S |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | N-[2-[4-(4-methylpiperazin-1-yl)butoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide |
| SMILES | CN1CCN(CCCCOc2cc(C(=O)N3CCCCc4sccc43)ccc2NC(=O)c2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C37H42N4O3S/c1-39-21-23-40(24-22-39)19-9-10-25-44-34-27-29(37(43)41-20-8-7-15-35-33(41)18-26-45-35)16-17-32(34)38-36(42)31-14-6-5-13-30(31)28-11-3-2-4-12-28/h2-6,11-14,16-18,26-27H,7-10,15,19-25H2,1H3,(H,38,42) |
| InChIKey | SSJBBNZWJHOPCO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|