C12H12BrN5 — CID 114905636
2-[(5-amino-1-methylpyrazol-4-yl)methylamino]-4-bromobenzonitrile (PubChem CID 114905636) has the molecular formula C12H12BrN5 and a molecular weight of 306.17 g/mol. Its IUPAC name is 2-[(5-amino-1-methylpyrazol-4-yl)methylamino]-4-bromobenzonitrile.
| Compound Name | 2-[(5-amino-1-methylpyrazol-4-yl)methylamino]-4-bromobenzonitrile |
|---|---|
| PubChem CID | 114905636 |
| Molecular Formula | C12H12BrN5 |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-[(5-amino-1-methylpyrazol-4-yl)methylamino]-4-bromobenzonitrile |
| SMILES | Cn1ncc(CNc2cc(Br)ccc2C#N)c1N |
| InChI | InChI=1S/C12H12BrN5/c1-18-12(15)9(7-17-18)6-16-11-4-10(13)3-2-8(11)5-14/h2-4,7,16H,6,15H2,1H3 |
| InChIKey | CZLUKUMHNLENRG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |