C15H22BrN3O — CID 114905646
4-bromo-2-[ethyl(piperidin-4-ylmethyl)amino]benzamide (PubChem CID 114905646) has the molecular formula C15H22BrN3O and a molecular weight of 340.26 g/mol. Its IUPAC name is 4-bromo-2-[ethyl(piperidin-4-ylmethyl)amino]benzamide.
| Compound Name | 4-bromo-2-[ethyl(piperidin-4-ylmethyl)amino]benzamide |
|---|---|
| PubChem CID | 114905646 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 4-bromo-2-[ethyl(piperidin-4-ylmethyl)amino]benzamide |
| SMILES | CCN(CC1CCNCC1)c1cc(Br)ccc1C(N)=O |
| InChI | InChI=1S/C15H22BrN3O/c1-2-19(10-11-5-7-18-8-6-11)14-9-12(16)3-4-13(14)15(17)20/h3-4,9,11,18H,2,5-8,10H2,1H3,(H2,17,20) |
| InChIKey | UYZYYCZJXMIKOQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |