C36H54N2O2Zr — CID 11490607
(6Z)-2,4-ditert-butyl-6-[[[(1S,2S)-2-[[(Z)-(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]cyclohexyl]amino]methylidene]cyclohexa-2,4-dien-1-one;zirconium (PubChem CID 11490607) has the molecular formula C36H54N2O2Zr and a molecular weight of 638.06 g/mol. Its IUPAC name is (6Z)-2,4-ditert-butyl-6-[[[(1S,2S)-2-[[(Z)-(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]cyclohexyl]amino]methylidene]cyclohexa-2,4-dien-1-one;zirconium.
| Compound Name | (6Z)-2,4-ditert-butyl-6-[[[(1S,2S)-2-[[(Z)-(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]cyclohexyl]amino]methylidene]cyclohexa-2,4-dien-1-one;zirconium |
|---|---|
| PubChem CID | 11490607 |
| Molecular Formula | C36H54N2O2Zr |
| Molecular Weight | 638.06 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | (6Z)-2,4-ditert-butyl-6-[[[(1S,2S)-2-[[(Z)-(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]cyclohexyl]amino]methylidene]cyclohexa-2,4-dien-1-one;zirconium |
| SMILES | CC(C)(C)C1=C/C(=C/N[C@H]2CCCC[C@@H]2N/C=C2/C=C(C(C)(C)C)C=C(C(C)(C)C)C2=O)C(=O)C(C(C)(C)C)=C1.[Zr] |
| InChI | InChI=1S/C36H54N2O2.Zr/c1-33(2,3)25-17-23(31(39)27(19-25)35(7,8)9)21-37-29-15-13-14-16-30(29)38-22-24-18-26(34(4,5)6)20-28(32(24)40)36(10,11)12;/h17-22,29-30,37-38H,13-16H2,1-12H3;/b23-21-,24-22-;/t29-,30-;/m0./s1 |
| InChIKey | DKGGXRXIFPJCLB-YAZOOCGISA-N |
| XLogP | 8.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.06 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|