C38H51BrN2O2 — CID 11490690
4-[(R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline bromide (PubChem CID 11490690) has the molecular formula C38H51BrN2O2 and a molecular weight of 647.74 g/mol. Its IUPAC name is 4-[(R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline bromide.
| Compound Name | 4-[(R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline bromide |
|---|---|
| PubChem CID | 11490690 |
| Molecular Formula | C38H51BrN2O2 |
| Molecular Weight | 647.74 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | 4-[(R)-[(2S,4S,5R)-1-[(3,5-ditert-butyl-4-methoxyphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline bromide |
| SMILES | C=CCO[C@H](c1ccnc2ccccc12)[C@@H]1C[C@@H]2CC[N+]1(Cc1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1)C[C@@H]2C=C.[Br-] |
| InChI | InChI=1S/C38H51N2O2.BrH/c1-10-20-42-35(30-16-18-39-33-15-13-12-14-29(30)33)34-23-28-17-19-40(34,25-27(28)11-2)24-26-21-31(37(3,4)5)36(41-9)32(22-26)38(6,7)8;/h10-16,18,21-22,27-28,34-35H,1-2,17,19-20,23-25H2,3-9H3;1H/q+1;/p-1/t27-,28-,34-,35+,40?;/m0./s1 |
| InChIKey | RSMKONSAENMOEX-FJPBIRCQSA-M |
| XLogP | 5.70 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.74 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|