C14H25F3N2O — CID 114908749
N-methyl-N-(4-methylpentan-2-yl)-5-(trifluoromethyl)piperidine-2-carboxamide (PubChem CID 114908749) has the molecular formula C14H25F3N2O and a molecular weight of 294.36 g/mol. Its IUPAC name is N-methyl-N-(4-methylpentan-2-yl)-5-(trifluoromethyl)piperidine-2-carboxamide.
| Compound Name | N-methyl-N-(4-methylpentan-2-yl)-5-(trifluoromethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114908749 |
| Molecular Formula | C14H25F3N2O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-methyl-N-(4-methylpentan-2-yl)-5-(trifluoromethyl)piperidine-2-carboxamide |
| SMILES | CC(C)CC(C)N(C)C(=O)C1CCC(C(F)(F)F)CN1 |
| InChI | InChI=1S/C14H25F3N2O/c1-9(2)7-10(3)19(4)13(20)12-6-5-11(8-18-12)14(15,16)17/h9-12,18H,5-8H2,1-4H3 |
| InChIKey | HRUYNJSOIGKUAT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |